| Name |
Pervilleine A |
| Formula |
C30H37NO11 |
| Mw |
587.23666103 |
| CAS RN |
356758-74-2 |
| C_ID |
C00041741
, 
|
| InChIKey |
OWTUMFZGWWGYGZ-ORDYZARTNA-N |
| InChICode |
InChI=1S/C30H37NO11/c1-31-19-14-18(41-30(34)17-12-23(37-4)29(40-7)24(13-17)38-5)15-20(31)27(26(19)33)42-25(32)9-8-16-10-21(35-2)28(39-6)22(11-16)36-3/h8-13,18-20,26-27,33H,14-15H2,1-7H3/b9-8+/t18-,19-,20+,26+,27-/m0/s1 |
| SMILES |
COc1cc(/C=C/C(=O)O[C@H]2[C@@H](O)[C@@H]3C[C@H](OC(=O)c4cc(OC)c(OC)c(OC)c4)C[C@H]2N3C)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum pervilei | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum pervillei | Ref. |
|
|
zoom in
| Organism | Erythroxylum pervilei | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|