| Name |
Cephalandole C
(+)-Cephalandole C |
| Formula |
C23H24N2O9 |
| Mw |
472.14818038 |
| CAS RN |
915396-12-2 |
| C_ID |
C00041424
, 
|
| InChIKey |
XUNXQNZGEZHUEQ-CEQIMWIZNA-N |
| InChICode |
InChI=1S/C23H24N2O9/c1-32-22(31)12-7-3-5-9-14(12)25-21(30)16-20(11-6-2-4-8-13(11)24-16)34-23-19(29)18(28)17(27)15(10-26)33-23/h2-9,15,17-19,23-24,26-29H,10H2,1H3,(H,25,30)/t15-,17-,18+,19-,23+/m1/s1 |
| SMILES |
COC(=O)c1ccccc1NC(=O)c1[nH]c2ccccc2c1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Anthranilate Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes cusia  | Ref. |
| - | - | Cephalanceropsis gracilis | Ref. |
|
|
zoom in
| Organism | Strobilanthes cusia |
|---|
| Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
