| Name |
8beta-Hydroxy-9(11),13-abietadien-12-one (-)-8beta-Hydroxy-9(11),13-abietadien-12-one |
| Formula |
C20H30O2 |
| Mw |
302.2245802 |
| CAS RN |
62716-38-5 |
| C_ID |
C00041294
, 
|
| InChIKey |
DWDOXTINEVOYSV-FHOCCHNENA-N |
| InChICode |
InChI=1S/C20H30O2/c1-13(2)14-12-20(22)10-7-16-18(3,4)8-6-9-19(16,5)17(20)11-15(14)21/h11-13,16,22H,6-10H2,1-5H3/t16-,19-,20+/m0/s1 |
| SMILES |
CC(C)C1=C[C@]2(O)CC[C@H]3C(C)(C)CCC[C@]3(C)C2=CC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus harringtonia | Ref. |
| Plantae | Labiatae | Salvia pachyphylla | Ref. |
|
|
zoom in
| Organism | Cephalotaxus harringtonia | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|