| Name |
10-Nonacosanol |
| Formula |
C29H60O |
| Mw |
424.46441654 |
| CAS RN |
504-55-2 |
| C_ID |
C00040761
, 
|
| InChIKey |
CPGCVOVWHCWVTP-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C29H60O/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28-29(30)27-25-23-21-10-8-6-4-2/h29-30H,3-28H2,1-2H3/t29-/m0/s1 |
| SMILES |
CCCCCCCCCCCCCCCCCCCC(O)CCCCCCCCC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cupressaceae | Thuja orientalis  | Ref. |
| Plantae | Cycadaceae | Cycas revoluta  | Ref. |
| Plantae | Fumariaceae | Corydalis taliensis | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Liliaceae | Tulipa gesneriana  | Ref. |
| Plantae | Nelumbonaceae | Nelumbo nucifera  | Ref. |
| Plantae | Papaveraceae | Chelidonium majus  | Ref. |
| Plantae | Papaveraceae | Dicranostigma franchetianum | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Taxaceae | Taxus mairei  | Ref. |
|
|
zoom in
| Organism | Thuja orientalis | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|