| Name |
Stictic acid |
| Formula |
C19H14O9 |
| Mw |
386.06378205 |
| CAS RN |
549-06-4 |
| C_ID |
C00040391
, 
|
| InChIKey |
SKCUFZLDTAYNBZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H14O9/c1-6-4-9(25-3)8(5-20)15-10(6)17(22)27-14-7(2)13(21)11-12(16(14)26-15)19(24)28-18(11)23/h4-5,19,21,24H,1-3H3/t19-/m1/s1 |
| SMILES |
COc1cc(C)c2c(c1C=O)Oc1c(c(C)c(O)c3c1C(O)OC3=O)OC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Cladoniaceae | Cladonia verticillata | Ref. |
| Fungi | Parmeliaceae | Usnea articulata  | Ref. |
| Plantae | Asteraceae | Conyza sticta | Ref. |
| - | - | Menegazzia asahinae | Ref. |
| - | - | Menegazzia terebrata | Ref. |
| - | - | Pseudocyphellaria impressa | Ref. |
|
|
zoom in
| Organism | Cladonia verticillata | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|