| Name |
1-Seneciovaltrate Seneciovaltrate |
| Formula |
C22H28O8 |
| Mw |
420.17841787 |
| CAS RN |
98260-42-5 |
| C_ID |
C00040277
, 
|
| InChIKey |
ZHFDCOHUCIESBS-MLYUBBHANA-N |
| InChICode |
InChI=1S/C22H28O8/c1-12(2)6-18(24)29-17-8-16-15(9-26-14(5)23)10-27-21(20(16)22(17)11-28-22)30-19(25)7-13(3)4/h7-8,10,12,17,20-21H,6,9,11H2,1-5H3/t17-,20+,21-,22+/m0/s1 |
| SMILES |
CC(=O)OCC1=CO[C@@H](OC(=O)C=C(C)C)[C@H]2C1=C[C@H](OC(=O)CC(C)C)[C@]21CO1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana sorbifolia | Ref. |
|
|
zoom in
| Organism | Valeriana officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|