| Name |
Prostratin |
| Formula |
C22H30O6 |
| Mw |
390.20423869 |
| CAS RN |
60857-08-1 |
| C_ID |
C00040076
, 
|
| InChIKey |
BOJKFRKNLSCGHY-MSAXGYQWNA-N |
| InChICode |
InChI=1S/C22H30O6/c1-11-6-16-20(26,18(11)25)9-14(10-23)7-15-17-19(4,5)21(17,28-13(3)24)8-12(2)22(15,16)27/h6-7,12,15-17,23,26-27H,8-10H2,1-5H3/t12-,15+,16-,17-,20-,21+,22-/m1/s1 |
| SMILES |
CC(=O)O[C@@]12C[C@@H](C)[C@@]3(O)[C@@H](C=C(CO)C[C@]4(O)C(=O)C(C)=C[C@@H]34)[C@@H]1C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Euphorbia fischeriana | Ref. |
| Plantae | Euphorbiaceae | Euphorbia fisheriana | Ref. |
| Plantae | Euphorbiaceae | Homalanthus acuminatus | Ref. |
| Plantae | Euphorbiaceae | Homalanthus nutans | Ref. |
| Plantae | Thymelaeaceae | Daphnopsis racemosa | Ref. |
| Plantae | Thymelaeaceae | Pimelea prostrata | Ref. |
| - | - | Stillingia sylvatica  | Ref. |
|
|
zoom in
| Organism | Euphorbia fischeriana | | Reference | Chen, et al., Lexicon of Active Componentsin in Plants, Vol1, Medicinal Science and Technology Press of China, Beijing, (2001) |
|---|
|