| Name |
Physanolide A (+)-Physanolide A |
| Formula |
C30H44O6 |
| Mw |
500.31378914 |
| CAS RN |
904892-54-2 |
| C_ID |
C00040013
, 
|
| InChIKey |
LJBZPBXYAKDOPD-HAOQNQGPNA-N |
| InChICode |
InChI=1S/C30H44O6/c1-15-24(33)11-18-14-35-27(34)30(18,5)23-13-22-20-7-6-17-10-19(32)12-25(36-16(2)31)29(17,4)21(20)8-9-28(22,3)26(15)23/h6,15,18-26,32-33H,7-14H2,1-5H3/t15-,18+,19-,20-,21+,22+,23+,24-,25+,26-,28+,29+,30+/m1/s1 |
| SMILES |
CC(=O)O[C@H]1C[C@H](O)CC2=CC[C@H]3[C@@H]4C[C@H]5[C@H]([C@H](C)[C@H](O)C[C@H]6COC(=O)[C@@]65C)[C@@]4(C)CC[C@@H]3[C@]21C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Datura metel  | Ref. |
| Plantae | Solanaceae | Physalis angulata  | Ref. |
|
|
zoom in
| Organism | Datura metel | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|