| Name |
Cudraxanthone G |
| Formula |
C24H26O5 |
| Mw |
394.17802394 |
| CAS RN |
130774-35-5 |
| C_ID |
C00038881
, 
|
| InChIKey |
IOCHCPAWAFKZJS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C24H26O5/c1-13(2)9-11-16-21(27)19-20(26)15-7-6-8-18(25)23(15)29-24(19)17(22(16)28-5)12-10-14(3)4/h6-10,25,27H,11-12H2,1-5H3 |
| SMILES |
COc1c(CC=C(C)C)c(O)c2c(=O)c3cccc(O)c3oc2c1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia amplexicaulis | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
|
|
zoom in
| Organism | Garcinia amplexicaulis | | Reference | Anu Aravind, A. P. et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective (2017), 19-75, ISBN:978-81-924674-5-0 |
|---|
|