| Name |
vis-Miaphenone C Vismiaphenone C |
| Formula |
C24H28O4 |
| Mw |
380.19875938 |
| CAS RN |
87338-97-4 |
| C_ID |
C00038001
, 
|
| InChIKey |
CFNHWEOECGZHRS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C24H28O4/c1-15(2)11-13-18-22(26)20(21(25)17-9-7-6-8-10-17)23(27)19(24(18)28-5)14-12-16(3)4/h6-12,26-27H,13-14H2,1-5H3 |
| SMILES |
COc1c(CC=C(C)C)c(O)c(C(=O)c2ccccc2)c(O)c1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia myrtifolia | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia pseudoguttifera  | Ref. |
|
|
zoom in
| Organism | Garcinia myrtifolia | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|