| Name |
11,12-Dehydroursolic acid lactone Ehretiolide Ursolic acid lactone |
| Formula |
C30H46O3 |
| Mw |
454.34469533 |
| CAS RN |
35959-05-8 |
| C_ID |
C00037978
, 
|
| InChIKey |
UVBLDLGZDSGCSN-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C30H46O3/c1-18-8-14-29-17-16-28(7)27(6)13-9-20-25(3,4)22(31)11-12-26(20,5)21(27)10-15-30(28,33-24(29)32)23(29)19(18)2/h10,15,18-23,31H,8-9,11-14,16-17H2,1-7H3/t18-,19+,20-,21-,22-,23-,26+,27+,28+,29-,30-/m0/s1 |
| SMILES |
CC1CCC23CCC4(C)C5(C)CCC6C(C)(C)C(O)CCC6(C)C5C=CC4(OC2=O)C3C1C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
| Plantae | Myrtaceae | Eucalyptus camaldulensis var.obtusa  | Ref. |
| Plantae | Myrtaceae | Eucalyptus tereticornis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
|
|
zoom in
| Organism | Centella asiatica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|