| Name |
Torachrysone |
| Formula |
C14H14O4 |
| Mw |
246.08920894 |
| CAS RN |
22649-04-3 |
| C_ID |
C00037918
, 
|
| InChIKey |
BIJOPUWEMBBDEG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C14H14O4/c1-7-4-9-5-10(18-3)6-11(16)13(9)14(17)12(7)8(2)15/h4-6,16-17H,1-3H3 |
| SMILES |
COc1cc(O)c2c(O)c(C(C)=O)c(C)cc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cassia tora  | Ref. |
| Plantae | Polygonaceae | Rheum maximowiczii | Ref. |
| Plantae | Polygonaceae | Rumex nepalensis | Ref. |
|
|
zoom in
| Organism | Cassia tora |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|
