| Name |
Myrtiaphenone A 6-Hydroxy-2,4-dimethoxy-3,5-bis(3-methyl-2-butenyl)benzophenone |
| Formula |
C25H30O4 |
| Mw |
394.21440945 |
| CAS RN |
93092-29-6 |
| C_ID |
C00037532
, 
|
| InChIKey |
QJYBJPASHULXLL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H30O4/c1-16(2)12-14-19-23(27)21(22(26)18-10-8-7-9-11-18)25(29-6)20(24(19)28-5)15-13-17(3)4/h7-13,27H,14-15H2,1-6H3 |
| SMILES |
COc1c(CC=C(C)C)c(O)c(C(=O)c2ccccc2)c(OC)c1CC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia myrtifolia | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia pseudoguttifera  | Ref. |
|
|
zoom in
| Organism | Garcinia myrtifolia | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|