| Name |
1,6-Di-O-galloyl-beta-glucose 1,6-di-O-Galloyl-beta-D-glucose |
| Formula |
C20H20O14 |
| Mw |
484.08530535 |
| CAS RN |
23363-08-8 |
| C_ID |
C00037193
, 
|
| InChIKey |
ZVTDSJFUFCKPJJ-NPNPCUTLNA-N |
| InChICode |
InChI=1S/C9H18O7/c1-4-6(12)7(13)8(14)9(15-4)16-5(2-10)3-11/h4-14H,2-3H2,1H3/t4-,6-,7-,8+,9+/m1/s1 |
| SMILES |
C[C@H]1O[C@@H](OC(CO)CO)[C@@H](O)[C@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Polygonaceae | Rheum officinale  | Ref. |
| Plantae | Polygonaceae | Rheum palmatum  | Ref. |
| Plantae | Polygonaceae | Rheum tanguticum  | Ref. |
|
|
zoom in
| Organism | Terminalia chebula | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|