| Name |
Daphnin |
| Formula |
C15H16O9 |
| Mw |
340.07943211 |
| CAS RN |
486-55-5 |
| C_ID |
C00037003
, 
|
| InChIKey |
HOIXTKAYCMNVMY-VTALYXRLNA-N |
| InChICode |
InChI=1S/C15H16O9/c16-5-8-10(18)12(20)13(21)15(23-8)22-7-3-1-6-2-4-9(17)24-14(6)11(7)19/h1-4,8,10,12-13,15-16,18-21H,5H2/t8-,10+,12+,13-,15+/m1/s1 |
| SMILES |
O=c1ccc2ccc(OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Rubiaceae | Cruciata taurica | Ref. |
| Plantae | Thymelaeaceae | Daphne arisanensis | Ref. |
| Plantae | Thymelaeaceae | Daphne cneorum | Ref. |
| Plantae | Thymelaeaceae | Daphne laureola  | Ref. |
| Plantae | Thymelaeaceae | Daphne mezereum  | Ref. |
| Plantae | Thymelaeaceae | Daphne oleoides ssp. oleoides  | Ref. |
| Plantae | Thymelaeaceae | Daphne striata | Ref. |
|
|
zoom in
| Organism | Matricaria chamomilla | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|