| Name |
Canthoside C (-)-Canthoside C Osmantolide |
| Formula |
C18H26O12 |
| Mw |
434.1424263 |
| CAS RN |
137319-13-2 |
| C_ID |
C00036877
, 
|
| InChIKey |
OWKFGCITOQSEDP-VMNLKLLANA-N |
| InChICode |
InChI=1S/C18H26O12/c1-26-10-4-8(2-3-9(10)20)29-16-14(23)13(22)12(21)11(30-16)5-27-17-15(24)18(25,6-19)7-28-17/h2-4,11-17,19-25H,5-7H2,1H3/t11-,12-,13+,14-,15+,16-,17-,18-/m1/s1 |
| SMILES |
COc1cc(O[C@@H]2O[C@H](CO[C@@H]3OC[C@](O)(CO)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Origanum dubium | Ref. |
| Plantae | Rubiaceae | Canthium berberidifolium | Ref. |
|
|
zoom in
| Organism | Origanum dubium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|