| Name |
5,3'-Dihydroxy-7,4'-dimethoxyflavanone 5,3'-Dihydroxy-7-4'-dimethoxyflavanone |
| Formula |
C17H16O6 |
| Mw |
316.09468824 |
| CAS RN |
5928-45-0 |
| C_ID |
C00036584
, 
|
| InChIKey |
LWBHKKLWSUFUNZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O6/c1-21-10-6-12(19)17-13(20)8-15(23-16(17)7-10)9-3-4-14(22-2)11(18)5-9/h3-7,15,18-19H,8H2,1-2H3/t15-/m1/s1 |
| SMILES |
COc1cc(O)c2c(c1)OC(c1ccc(OC)c(O)c1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium glutinosum | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
|
|
zoom in
| Organism | Heliotropium glutinosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|