| Name |
(-)-Isochaminic acid |
| Formula |
C10H14O2 |
| Mw |
166.09937969 |
| CAS RN |
129085-66-1 |
| C_ID |
C00036246
, 
|
| InChIKey |
BKLAIYZBALVMQV-HGXVMFPFNA-N |
| InChICode |
InChI=1S/C10H14O2/c1-10(2)7-4-3-6(9(11)12)5-8(7)10/h5,7-8H,3-4H2,1-2H3,(H,11,12)/t7-,8+/m0/s1 |
| SMILES |
CC1(C)[C@@H]2C=C(C(=O)O)CC[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina anisochroma | Ref. |
| Plantae | Phyllanthaceae | Bridelia retusa  | Ref. |
| - | - | bridelia retusa | Ref. |
|
|
zoom in
| Organism | Ageratina anisochroma | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|