| Name |
Tellimagrandin II |
| Formula |
C41H30O26 |
| Mw |
938.10253114 |
| CAS RN |
81571-72-4 |
| C_ID |
C00036226
, 
|
| InChIKey |
JCGHAEBIBSEQAD-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2/t23-,33-,34-,35-,41+/m0/s1 |
| SMILES |
O=C(OC1OC2COC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)OC2C(OC(=O)c2cc(O)c(O)c(O)c2)C1OC(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Myrtaceae | Eugenia caryophyllata  | Ref. |
| Plantae | Rosaceae | Filipendula ulmaria  | Ref. |
| Plantae | Rosaceae | Geum japonicum  | Ref. |
| Plantae | Saxifragaceae | Tellima grandiflora | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|