| Name |
Methyl orsellinate |
| Formula |
C9H10O4 |
| Mw |
182.05790881 |
| CAS RN |
3187-58-4 |
| C_ID |
C00036143
, 
|
| InChIKey |
NCCWCZLEACWJIN-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h3-4,10-11H,1-2H3 |
| SMILES |
COC(=O)c1c(C)cc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Umbilicariaceae | Umbilicaria hypococcinea | Ref. |
| Plantae | Amaranthaceae | Amaranthus hypochondriacus  | Ref. |
| Plantae | Asteraceae | Flourensia cernua | Ref. |
| Plantae | Hemerocallidaceae | Dianella ensifolia  | Ref. |
| - | - | Florensia cernua | Ref. |
|
|
zoom in
| Organism | Umbilicaria hypococcinea | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Lojanapiwatna, et al., Chem Abstr, 97, (1982), 178728j.
Mata, et al., Phytochemistry, 64, (2003), 285 |
|---|
|