| Name |
Brassicasterone Ergosta-4,22-dien-3-one |
| Formula |
C28H44O |
| Mw |
396.33921603 |
| CAS RN |
4030-92-6 |
| C_ID |
C00036116
, 
|
| InChIKey |
OWYXOXZSAKVGHJ-SEBUYRCCNA-N |
| InChICode |
InChI=1S/C28H44O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-8,17-20,23-26H,9-16H2,1-6H3/b8-7+/t19-,20-,23-,24+,25-,26-,27-,28+/m0/s1 |
| SMILES |
CC(/C=C/[C@H](C)C(C)C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Salvia multicaulis  | Ref. |
| - | - | Crotone hieronymi | Ref. |
|
|
zoom in
| Organism | Salvia multicaulis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|