| Name |
Tropic acid |
| Formula |
C9H10O3 |
| Mw |
166.06299419 |
| CAS RN |
552-63-6 |
| C_ID |
C00035885
, 
|
| InChIKey |
JACRWUWPXAESPB-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C9H10O3/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/t8-/m0/s1 |
| SMILES |
O=C(O)C(CO)c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Erythroxylaceae | Erythroxylum australe | Ref. |
| Plantae | Solanaceae | Datura stamonium | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
|
|
zoom in
| Organism | Erythroxylum australe | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|