| Name |
alpha-Fenchol alpha-Fenchylalcohol endo-Fenchol alpha-Fenchyl alcohol |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
14575-74-7 |
| C_ID |
C00035801
, 
|
| InChIKey |
IAIHUHQCLTYTSF-AFAAIUEZNA-N |
| InChICode |
InChI=1S/C10H18O/c1-9(2)7-4-5-10(3,6-7)8(9)11/h7-8,11H,4-6H2,1-3H3/t7-,8-,10+/m1/s1 |
| SMILES |
CC1(C)[C@@H]2CC[C@@](C)(C2)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes ixiocephala | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Conyza newii  | Ref. |
| Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Tetradenia riparia  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
|
|
zoom in
| Organism | Strobilanthes ixiocephala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|