| Name |
2-O-Acetylmaslinic acid (+)-2-O-Acetylmaslinic acid Lawsoshamim |
| Formula |
C32H50O5 |
| Mw |
514.36582471 |
| CAS RN |
758718-51-3 |
| C_ID |
C00035485
, 
|
| InChIKey |
SLLMHUNWRZOHCM-VRZXRPPGNA-N |
| InChICode |
InChI=1S/C32H50O5/c1-19(33)37-22-18-29(6)23(28(4,5)25(22)34)11-12-31(8)24(29)10-9-20-21-17-27(2,3)13-15-32(21,26(35)36)16-14-30(20,31)7/h9,21-25,34H,10-18H2,1-8H3,(H,35,36)/t21-,22+,23-,24+,25-,29-,30+,31+,32-/m0/s1 |
| SMILES |
CC(=O)O[C@@H]1C[C@]2(C)[C@H]3CC=C4[C@@H]5CC(C)(C)CC[C@]5(C(=O)O)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus dombeyi  | Ref. |
|
|
zoom in
| Organism | Lawsonia alba | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|