| Name |
1,2,6-Tri-O-galloyl-beta-glucopyranose 1,2,6-tri-O-Galloyl-beta-D-glucose |
| Formula |
C27H24O18 |
| Mw |
636.09626397 |
| CAS RN |
79886-49-0 |
| C_ID |
C00035453
, 
|
| InChIKey |
LLENXGNWVNSBQG-OHQJYYNGNA-N |
| InChICode |
InChI=1S/C27H24O18/c28-11-1-8(2-12(29)18(11)34)24(39)42-7-17-21(37)22(38)23(44-25(40)9-3-13(30)19(35)14(31)4-9)27(43-17)45-26(41)10-5-15(32)20(36)16(33)6-10/h1-6,17,21-23,27-38H,7H2/t17-,21-,22+,23-,27-/m1/s1 |
| SMILES |
O=C(OC[C@H]1OC(OC(=O)c2cc(O)c(O)c(O)c2)[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H](O)[C@@H]1O)c1cc(O)c(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Melastomataceae | Monochaetum multiflorum | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|