| Name |
Puberanine |
| Formula |
C32H44N2O9 |
| Mw |
600.30468102 |
| CAS RN |
83685-20-5 |
| C_ID |
C00035377
, 
|
| InChIKey |
XTSVKUJYTUPYRJ-FUQPHDHNNA-N |
| InChICode |
InChI=1S/C32H44N2O9/c1-6-34-16-28(43-26(36)18-9-7-8-10-20(18)33-17(2)35)12-11-24(41-4)31-22-13-19-21(40-3)14-30(38,32(22,39)25(19)42-5)29(37,27(31)34)15-23(28)31/h7-10,19,21-25,27,37-39H,6,11-16H2,1-5H3,(H,33,35)/t19-,21+,22+,23-,24-,25+,27-,28-,29-,30+,31-,32+/m1/s1 |
| SMILES |
CCN1C[C@]2(OC(=O)c3ccccc3NC(C)=O)CC[C@@H](OC)C34C1C(O)(C[C@@H]32)[C@@]1(O)C[C@H](OC)[C@H]2C[C@@H]4[C@]1(O)[C@H]2OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum barbatum var.puberulum | Ref. |
| Plantae | Ranunculaceae | Aconitum laeve | Ref. |
| Plantae | Ranunculaceae | Aconitum puberulum | Ref. |
|
|
zoom in
| Organism | Aconitum barbatum var.puberulum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Shaheen, et al., Phytochemistry, 66, (2005), 935 |
|---|
|