| Name |
Eucalbanin B Cornusiin A |
| Formula |
C68H50O44 |
| Mw |
1570.16749498 |
| CAS RN |
95263-69-7 |
| C_ID |
C00035272
, 
|
| InChIKey |
CGTQPVKZNROYFH-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C68H50O44/c69-12-37(107-61(96)16-1-24(71)43(83)25(72)2-16)59(111-62(97)17-3-26(73)44(84)27(74)4-17)57-35(82)15-105-65(100)22-11-36(50(90)54(94)42(22)41-21(67(102)109-57)9-32(79)48(88)53(41)93)106-56-23(10-33(80)49(89)55(56)95)68(103)108-38(13-70)60(112-63(98)18-5-28(75)45(85)29(76)6-18)58-34(81)14-104-64(99)19-7-30(77)46(86)51(91)39(19)40-20(66(101)110-58)8-31(78)47(87)52(40)92/h1-13,34-35,37-38,57-60,71-95H,14-15H2/t34-,35+,37-,38-,57+,58+,59+,60-/m1/s1 |
| SMILES |
O=CC(OC(=O)c1cc(O)c(O)c(O)c1Oc1cc2c(c(O)c1O)-c1c(cc(O)c(O)c1O)C(=O)OC(C(OC(=O)c1cc(O)c(O)c(O)c1)C(C=O)OC(=O)c1cc(O)c(O)c(O)c1)C(O)COC2=O)C(OC(=O)c1cc(O)c(O)c(O)c1)C1OC(=O)c2cc(O)c(O)c(O)c2-c2c(cc(O)c(O)c2O)C(=O)OCC1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Tamaricaceae | Reaumuria hirtella | Ref. |
|
|
zoom in
| Organism | Camptotheca acuminata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|