| Name |
beta-Apopicropodophyllin |
| Formula |
C22H20O7 |
| Mw |
396.12090299 |
| CAS RN |
477-52-1 |
| C_ID |
C00034971
, 
|
| InChIKey |
OPGVEBTYBAOEHZ-TWYLJJHKNA-N |
| InChICode |
InChI=1S/C22H20O7/c1-24-17-6-12(7-18(25-2)21(17)26-3)19-14-8-16-15(28-10-29-16)5-11(14)4-13-9-27-22(23)20(13)19/h5-8,19H,4,9-10H2,1-3H3/t19-/m1/s1 |
| SMILES |
COc1cc([C@H]2C3=C(COC3=O)Cc3cc4c(cc32)OCO4)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Podophyllum emodi  | Ref. |
| Plantae | Linderniaceae | Micranthemum umbrosum | Ref. |
|
|
zoom in
| Organism | Podophyllum emodi | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|