| Name |
Tribuloside Tribuloside A |
| Formula |
C30H26O13 |
| Mw |
594.13734092 |
| CAS RN |
22153-44-2 |
| C_ID |
C00034908
, 
|
| InChIKey |
DVGGLGXQSFURLP-FWCIUELMNA-N |
| InChICode |
InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(35)40-13-21-24(36)26(38)27(39)30(42-21)43-29-25(37)23-19(34)11-18(33)12-20(23)41-28(29)15-4-8-17(32)9-5-15/h1-12,21,24,26-27,30-34,36,38-39H,13H2/b10-3+/t21-,24-,26+,27-,30+/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Malvaceae | Malva parviflora  | Ref. |
| Plantae | Zygophyllaceae | Tribulus alatus Del.  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
|
|
zoom in
| Organism | Malva parviflora | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|