| Name |
cis-Nerolidol (Z)-Nerolidol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
3790-78-1 |
| C_ID |
C00034757
, 
|
| InChIKey |
FQTLCLSUCSAZDY-KAMYIIQDNA-N |
| InChICode |
InChI=1S/C15H26O/c1-6-15(5,16)12-8-11-14(4)10-7-9-13(2)3/h6,9,11,16H,1,7-8,10,12H2,2-5H3/b14-11-/t15-/m1/s1 |
| SMILES |
C=CC(C)(O)CC/C=C(/C)CCC=C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Tanacetum longifolium | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Verbenaceae | Lantana camara L.  | Ref. |
| - | - | Baeckea frutescens L.  | Ref. |
| - | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
| Organism | Ageratina conyzoides | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|