| Name |
Sanjoinine B |
| Formula |
C30H40N4O4 |
| Mw |
520.30495579 |
| CAS RN |
107462-33-9 |
| C_ID |
C00034675
, 
|
| InChIKey |
VABCJXJBSCOYDW-WUKNDPDINA-N |
| InChICode |
InChI=1S/C30H40N4O4/c1-6-20(4)25-29(36)32-17-16-21-12-14-23(15-13-21)38-27(19(2)3)26(30(37)33-25)34-28(35)24(31-5)18-22-10-8-7-9-11-22/h7-17,19-20,24-27,31H,6,18H2,1-5H3,(H,32,36)(H,33,37)(H,34,35)/b17-16+/t20-,24-,25-,26+,27-/m1/s1 |
| SMILES |
CCC(C)C1NC(=O)C(NC(=O)C(Cc2ccccc2)NC)C(C(C)C)Oc2ccc(cc2)/C=C/NC1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Zizyphus jujube var. inermis | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris var.spinosus | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba var.spinosa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|