| Name |
Minutoside B (-)-Minutoside B |
| Formula |
C35H59NO12S |
| Mw |
717.37579709 |
| CAS RN |
863919-29-3 |
| C_ID |
C00034606
, 
|
| InChIKey |
ZNIBBCNKCIEYFM-HIBTXMNANA-N |
| InChICode |
InChI=1S/C35H59NO12S/c1-18(20(3)31(42)36-12-13-49(44,45)46)6-7-19(2)22-15-24(37)30-34(22,5)11-9-27-33(4)10-8-21(14-23(33)25(38)16-35(27,30)43)48-32-29(41)28(40)26(39)17-47-32/h6-7,18-30,32,37-41,43H,8-17H2,1-5H3,(H,36,42)(H,44,45,46)/b7-6+/t18-,19+,20+,21+,22-,23-,24-,25+,26-,27-,28+,29-,30-,32+,33+,34-,35+/m1/s1 |
| SMILES |
C[C@H](/C=C/[C@@H](C)[C@H]1C[C@@H](O)[C@@H]2[C@]1(C)CC[C@@H]1[C@@]3(C)CC[C@H](O[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)C[C@@H]3[C@@H](O)C[C@]12O)[C@H](C)C(=O)NCCS(=O)(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium albopilosum | Ref. |
| Plantae | Alliaceae | Allium karataviense | Ref. |
| Plantae | Alliaceae | Allium minutiflorum | Ref. |
| Plantae | Alliaceae | Allium ostrowskianum | Ref. |
|
|
zoom in
| Organism | Allium albopilosum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|