| Name |
Lyfoline |
| Formula |
C25H27NO5 |
| Mw |
421.18892298 |
| CAS RN |
30356-01-5 |
| C_ID |
C00034043
, 
|
| InChIKey |
CDTGNBVPXHNHGE-XLTNJPPBNA-N |
| InChICode |
InChI=1S/C25H27NO5/c1-30-24-14-18-19(13-23(24)28)21-12-17(11-16-4-2-3-9-26(16)21)31-25(29)8-6-15-5-7-22(27)20(18)10-15/h5-8,10,13-14,16-17,21,27-28H,2-4,9,11-12H2,1H3/b8-6-/t16-,17-,21-/m0/s1 |
| SMILES |
COc1cc2c(cc1O)[C@@H]1C[C@H](C[C@@H]3CCCCN31)OC(=O)/C=Cc1ccc(O)c-2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Lys |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lycopodiaceae | Lycopodium annotinum | Ref. |
| Plantae | Lythraceae | Heimia salicifolia  | Ref. |
|
|
zoom in
| Organism | Lycopodium annotinum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|