| Name |
Hellebrigenin 3beta,5beta,14beta-Trihydroxy-19-oxo-bufa-20,22-dienolide 3-O-beta-D-glucopyranoside |
| Formula |
C24H32O6 |
| Mw |
416.21988875 |
| CAS RN |
465-90-7 |
| C_ID |
C00033905
, 
|
| InChIKey |
TVKPTWJPKVSGJB-AUCPALTMNA-N |
| InChICode |
InChI=1S/C24H32O6/c1-21-8-5-18-19(6-10-23(28)12-16(26)4-9-22(18,23)14-25)24(21,29)11-7-17(21)15-2-3-20(27)30-13-15/h2-3,13-14,16-19,26,28-29H,4-12H2,1H3/t16-,17+,18-,19+,21+,22-,23-,24-/m0/s1 |
| SMILES |
C[C@]12CC[C@H]3[C@@H](CC[C@]4(O)C[C@@H](O)CC[C@]34C=O)[C@@]1(O)CC[C@@H]2c1ccc(=O)oc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Kalanchoe gracilis | Ref. |
| Plantae | Ranunculaceae | Helleborus caucasicus | Ref. |
|
|
zoom in
| Organism | Kalanchoe gracilis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|