| Name |
Calleryanin |
| Formula |
C13H18O8 |
| Mw |
302.10016755 |
| CAS RN |
20300-53-2 |
| C_ID |
C00033688
, 
|
| InChIKey |
AWHHJEGHYHOVRN-BNWABVEUNA-N |
| InChICode |
InChI=1S/C13H18O8/c14-4-6-1-2-8(7(16)3-6)20-13-12(19)11(18)10(17)9(5-15)21-13/h1-3,9-19H,4-5H2/t9-,10+,11+,12-,13-/m1/s1 |
| SMILES |
OCc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Longaniaceae | Strychnos axillaris | Ref. |
|
|
zoom in
| Organism | Origanum vulgare | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|