| Name |
Bannaxanthone G |
| Formula |
C28H30O8 |
| Mw |
494.19406794 |
| CAS RN |
1065274-15-8 |
| C_ID |
C00033672
, 
|
| InChIKey |
PJXDVRULNHKRSJ-MKMNVTDBNA-N |
| InChICode |
InChI=1S/C28H30O8/c1-13(2)18(30)10-17-26-16(8-9-28(4,5)36-26)24(33)22-25(34)21-15(7-6-14(3)12-29)23(32)19(31)11-20(21)35-27(17)22/h6,8-9,11,18,29-33H,1,7,10,12H2,2-5H3/b14-6+/t18-/m1/s1 |
| SMILES |
C=C(C)C(O)Cc1c2c(c(O)c3c(=O)c4c(C/C=C(C)CO)c(O)c(O)cc4oc13)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xipshuanbannaensis | Ref. |
| - | - | Garcina xipshuanbannaensis | Ref. |
|
|
zoom in
| Organism | Garcinia xipshuanbannaensis |
|---|
| Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|
