| Name |
Bannaxanthone F |
| Formula |
C28H32O9 |
| Mw |
512.20463262 |
| CAS RN |
1065175-97-4 |
| C_ID |
C00033671
, 
|
| InChIKey |
WCAZWPKNYZBYGB-AWNIVKPZNA-N |
| InChICode |
InChI=1S/C28H32O9/c1-13(12-29)6-7-14-20-18(11-17(30)22(14)32)36-26-16(10-19(31)28(4,5)35)25-15(8-9-27(2,3)37-25)23(33)21(26)24(20)34/h6,8-9,11,19,29-33,35H,7,10,12H2,1-5H3/b13-6+/t19-/m0/s1 |
| SMILES |
C/C(=CCc1c(O)c(O)cc2oc3c(CC(O)C(C)(C)O)c4c(c(O)c3c(=O)c12)C=CC(C)(C)O4)CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xipshuanbannaensis | Ref. |
| - | - | Garcina xipshuanbannaensis | Ref. |
|
|
zoom in
| Organism | Garcinia xipshuanbannaensis | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|