| Name |
Bannaxanthone E |
| Formula |
C28H30O7 |
| Mw |
478.19915331 |
| CAS RN |
1065274-14-7 |
| C_ID |
C00033670
, 
|
| InChIKey |
WFSOBGJMPBOKDO-VIZOYTHASA-N |
| InChICode |
InChI=1S/C28H30O7/c1-14(2)6-8-18-26-17(10-11-28(4,5)35-26)24(32)22-25(33)21-16(9-7-15(3)13-29)23(31)19(30)12-20(21)34-27(18)22/h6-7,10-12,29-32H,8-9,13H2,1-5H3/b15-7+ |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c(=O)c4c(C/C=C(C)CO)c(O)c(O)cc4oc13)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xipshuanbannaensis | Ref. |
| - | - | Garcina xipshuanbannaensis | Ref. |
|
|
zoom in
| Organism | Garcinia xipshuanbannaensis | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|