| Name |
Bannaxanthone A |
| Formula |
C23H26O7 |
| Mw |
414.16785319 |
| CAS RN |
1065274-10-3 |
| C_ID |
C00033666
, 
|
| InChIKey |
WQZVUXSZXOOQQD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H26O7/c1-11(2)5-6-13-18-16(10-15(25)20(13)26)30-17-9-14(24)12(7-8-23(3,4)29)21(27)19(17)22(18)28/h5,9-10,24-27,29H,6-8H2,1-4H3 |
| SMILES |
CC(C)=CCc1c(O)c(O)cc2oc3cc(O)c(CCC(C)(C)O)c(O)c3c(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia xipshuanbannaensis | Ref. |
| - | - | Garcina xipshuanbannaensis | Ref. |
|
|
zoom in
| Organism | Garcinia xipshuanbannaensis | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|