| Name |
4'-Hydroxy-5,7-dimethoxyflavone 5,7-Dimethoxy-4'-hydroxyflavone |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
16290-50-9 |
| C_ID |
C00033568
, 
|
| InChIKey |
ARICZLGTUHLTFQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O5/c1-20-12-7-15(21-2)17-13(19)9-14(22-16(17)8-12)10-3-5-11(18)6-4-10/h3-9,18H,1-2H3 |
| SMILES |
COc1cc(OC)c2c(=O)cc(-c3ccc(O)cc3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes formosanus | Ref. |
| Plantae | Acanthaceae | Strobilanthes japonicus | Ref. |
| Plantae | Zingiberaceae | Kaempferia parviflora  | Ref. |
|
|
zoom in
| Organism | Strobilanthes formosanus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|