| Name |
Verpectoside A (-)-Verpectoside A |
| Formula |
C35H46O19 |
| Mw |
770.26332929 |
| CAS RN |
448963-58-4 |
| C_ID |
C00033467
, 
|
| InChIKey |
DVKADJHCAQTKAS-FYBIWWRKNA-N |
| InChICode |
InChI=1S/C35H46O19/c1-15-25(42)27(44)29(46)34(50-15)53-31-30(52-24(41)8-5-16-4-7-19(38)22(12-16)47-2)23(13-36)51-35(48-10-9-17-3-6-18(37)20(39)11-17)32(31)54-33-28(45)26(43)21(40)14-49-33/h3-8,11-12,15,21,23,25-40,42-46H,9-10,13-14H2,1-2H3/b8-5+/t15-,21-,23+,25-,26-,27+,28+,29+,30+,31-,32+,33-,34-,35+/m0/s1 |
| SMILES |
COc1cc(/C=C/C(=O)O[C@H]2[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O[C@@H]3OC[C@H](O)[C@H](O)[C@H]3O)[C@H](OCCc3ccc(O)c(O)c3)O[C@@H]2CO)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Veronica multifida | Ref. |
| Plantae | Plantaginaceae | Veronica pectinata var.glandulosa | Ref. |
| Plantae | Plantaginaceae | Veronica prectinata var.glandulosa | Ref. |
|
|
zoom in
| Organism | Veronica multifida | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|