| Name |
Monodemethoxycurcumin p-Hydroxycinnamoyl feruloyl methane |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
24939-17-1 |
| C_ID |
C00033297
, 
|
| InChIKey |
HJTVQHVGMGKONQ-LUZURFALSA-N |
| InChICode |
InChI=1S/C20H18O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-12,21,24H,13H2,1H3/b9-4+,10-5+ |
| SMILES |
COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)cc2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
| Plantae | Zingiberaceae | Curcuma chuanyujin | Ref. |
| Plantae | Zingiberaceae | Curcuma doestica | Ref. |
| Plantae | Zingiberaceae | Curcuma zanthorrhiza | Ref. |
|
|
zoom in
| Organism | Curcuma aromatica | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|