| Name |
Isooxypeucedanin |
| Formula |
C16H14O5 |
| Mw |
286.08412356 |
| CAS RN |
5058-15-1 |
| C_ID |
C00033066
, 
|
| InChIKey |
USLPJJIUMAKBIU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H14O5/c1-9(2)12(17)8-20-16-10-3-4-15(18)21-14(10)7-13-11(16)5-6-19-13/h3-7,9H,8H2,1-2H3 |
| SMILES |
CC(C)C(=O)COc1c2ccoc2cc2oc(=O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica sylvestris  | Ref. |
| Plantae | Apiaceae | Angelica taiwaniana | Ref. |
| Plantae | Apiaceae | Ferulago turcomanica | Ref. |
| Plantae | Apiaceae | Niphogeton ternata | Ref. |
| Plantae | Apiaceae | Peucedanum ostruthium  | Ref. |
| Plantae | Apiaceae | Prangos latiloba | Ref. |
| Plantae | Apiaceae | Seseli webbii Cosson. | Ref. |
|
|
zoom in
| Organism | Angelica sylvestris | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
DUAN, et al., Chem Pharm Bull, 50, (2002), 115 |
|---|
|