| Name |
Cnidilin Knidilin Isophellopterin |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
14348-22-2 |
| C_ID |
C00032846
, 
|
| InChIKey |
NNDOCYLWULORAM-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H16O5/c1-10(2)6-8-20-14-11-4-5-13(18)22-16(11)17(19-3)15-12(14)7-9-21-15/h4-7,9H,8H2,1-3H3 |
| SMILES |
COc1c2occc2c(OCC=C(C)C)c2ccc(=O)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica taiwaniana | Ref. |
| Plantae | Apiaceae | Niphogeton ternata | Ref. |
| Plantae | Moraceae | Dorstenia gigas | Ref. |
|
|
zoom in
| Organism | Angelica taiwaniana | | Reference | DUAN, et al., Chem Pharm Bull, 50, (2002), 115.
Ahua, et al., Phytochemistry, 65, (2004), 963.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|