| Name |
Taraxerone |
| Formula |
C30H48O |
| Mw |
424.37051615 |
| CAS RN |
514-07-8 |
| C_ID |
C00032287
, 
|
| InChIKey |
DBCAVZSSFGIHQZ-MEFPNMSFNA-N |
| InChICode |
InChI=1S/C30H48O/c1-25(2)17-18-27(5)13-9-21-29(7)14-10-20-26(3,4)24(31)12-16-28(20,6)22(29)11-15-30(21,8)23(27)19-25/h9,20,22-23H,10-19H2,1-8H3/t20-,22+,23+,27-,28-,29-,30+/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C)CC=C3[C@]4(C)CC[C@H]5C(C)(C)C(=O)CC[C@]5(C)[C@H]4CC[C@@]3(C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Adhatoda vasica  | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Asteraceae | Crossostephium chinense | Ref. |
| Plantae | Betulaceae | Alnus glutinosa  | Ref. |
| Plantae | Betulaceae | Alnus incana  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum bracteatum | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Ebenaceae | Diospyros acuta | Ref. |
| Plantae | Ebenaceae | Diospyros ferrea | Ref. |
| Plantae | Ebenaceae | Diospyros lotus  | Ref. |
| Plantae | Ebenaceae | Diospyros moonii | Ref. |
| Plantae | Ebenaceae | Diospyros oblongifolia | Ref. |
| Plantae | Ebenaceae | Diospyros oppositifolia | Ref. |
| Plantae | Ebenaceae | Diospyros quaesita | Ref. |
| Plantae | Ebenaceae | Diospyros rheophytica | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Ebenaceae | Diospyros thwaitesii | Ref. |
| Plantae | Euphorbiaceae | Cleidion spiciflorum (Burm. f.) Merr.  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia antiquorum  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia stygiana | Ref. |
| Plantae | Euphorbiaceae | Euphorbia tirucalli  | Ref. |
| Plantae | Euphorbiaceae | Excoecaria agallocha L.  | Ref. |
| Plantae | Euphorbiaceae | Manihot esculenta  | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Malvaceae | Adansonia digitata  | Ref. |
| Plantae | Myrsinaceae | Embelia schimperi  | Ref. |
| Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
| Plantae | Polygonaceae | Polygonum nepalense | Ref. |
| Plantae | Rutaceae | Skimmia wallachii | Ref. |
|
|
zoom in
| Organism | Adhatoda vasica | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|