| Name |
3beta,27-Dihydroxy-12-oleanen-28-oic acid Myricerol |
| Formula |
C30H48O4 |
| Mw |
472.35526002 |
| CAS RN |
55497-67-1 |
| C_ID |
C00032041
, 
|
| InChIKey |
ADBMMSFXIFGNAX-PNFVKZQLNA-N |
| InChICode |
InChI=1S/C30H48O4/c1-25(2)13-14-29(24(33)34)15-16-30(18-31)19(20(29)17-25)7-8-22-27(5)11-10-23(32)26(3,4)21(27)9-12-28(22,30)6/h7,20-23,31-32H,8-18H2,1-6H3,(H,33,34)/t20-,21-,22+,23-,27-,28+,29-,30-/m0/s1 |
| SMILES |
CC1(C)CC[C@]2(C(=O)O)CC[C@]3(CO)C(=CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
|
|
zoom in
| Organism | Nerium oleander | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|