| Name |
Nudiposide |
| Formula |
C27H36O12 |
| Mw |
552.22067662 |
| CAS RN |
62058-46-2 |
| C_ID |
C00030867
, 
|
| InChIKey |
GWDZRGQRNHELQM-ZWJPBFSSNA-N |
| InChICode |
InChI=1S/C27H36O12/c1-34-17-7-13(8-18(35-2)23(17)31)20-15(10-38-27-25(33)22(30)16(29)11-39-27)14(9-28)5-12-6-19(36-3)24(32)26(37-4)21(12)20/h6-8,14-16,20,22,25,27-33H,5,9-11H2,1-4H3/t14-,15-,16+,20+,22-,25-,27+/m1/s1 |
| SMILES |
COc1cc([C@@H]2c3c(cc(OC)c(O)c3OC)C[C@H](CO)[C@H]2CO[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum dilatatum | Ref. |
| Plantae | Cucurbitaceae | Neoalsomitra integrifoliola | Ref. |
| Plantae | Fabaceae | Saraca asoca  | Ref. |
| Plantae | Lauraceae | Machilus thunbergii  | Ref. |
| Plantae | Meliaceae | Aphanamixis polystachya  | Ref. |
|
|
zoom in
| Organism | Viburnum dilatatum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Ogawa, et al., Chem Pharm Bull, 24, (1976), 2102 |
|---|
|