| Name |
Isoprocurcumenol |
| Formula |
C15H22O2 |
| Mw |
234.16197995 |
| CAS RN |
102130-90-5 |
| C_ID |
C00030542
, 
|
| InChIKey |
ITIGZFMSPAFZAE-NVOPMDDPNA-N |
| InChICode |
InChI=1S/C15H22O2/c1-9(2)12-8-13-11(5-6-15(13,4)17)10(3)7-14(12)16/h11,13,17H,3,5-8H2,1-2,4H3/t11-,13-,15-/m0/s1 |
| SMILES |
C=C1CC(=O)C(=C(C)C)C[C@H]2[C@H]1CC[C@]2(C)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
MATSUDA, et al., Chem Pharm Bull, 49, (2001), 1558 |
|---|
|