| Name |
6alpha-Hydroxygeniposide Deacetylasperulosidic acid methyl ester Methyl deacetylasperulosidate |
| Formula |
C17H24O11 |
| Mw |
404.13186161 |
| CAS RN |
52613-28-2 |
| C_ID |
C00030094
, 
|
| InChIKey |
WSGPLSDARZNMCW-LCTARJBHNA-N |
| InChICode |
InChI=1S/C17H24O11/c1-25-15(24)7-5-26-16(10-6(3-18)2-8(20)11(7)10)28-17-14(23)13(22)12(21)9(4-19)27-17/h2,5,8-14,16-23H,3-4H2,1H3/t8-,9-,10-,11+,12-,13+,14-,16+,17+/m1/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2C(CO)=C[C@H](O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Rubiaceae | Adina polycephala Benth | Ref. |
| Plantae | Rubiaceae | Gardenia jasminoides cv.fortuneana HARA  | Ref. |
| Plantae | Rubiaceae | Genipa americana  | Ref. |
| Plantae | Rubiaceae | Oldenlandia corymbosa | Ref. |
| Plantae | Rubiaceae | Paederia scandens  | Ref. |
| Plantae | Rubiaceae | Randia spinosa  | Ref. |
| Plantae | Rubiaceae | Rothmannia macrophylla | Ref. |
|
|
zoom in
| Organism | Plantago major | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|