| Name |
Curillin G (-)-Curillin G |
| Formula |
C39H64O13 |
| Mw |
740.43469213 |
| CAS RN |
150677-83-1 |
| C_ID |
C00030069
, 
|
| InChIKey |
GUSVHVVOABZHAH-AAAKZVRZNA-N |
| InChICode |
InChI=1S/C39H64O13/c1-18-7-12-39(47-17-18)19(2)28-25(52-39)14-24-22-6-5-20-13-21(8-10-37(20,3)23(22)9-11-38(24,28)4)48-35-33(46)31(44)34(27(16-41)50-35)51-36-32(45)30(43)29(42)26(15-40)49-36/h18-36,40-46H,5-17H2,1-4H3/t18-,19-,20+,21-,22+,23-,24-,25-,26+,27+,28-,29-,30-,31+,32+,33+,34-,35+,36-,37-,38-,39+/m0/s1 |
| SMILES |
C[C@H]1CC[C@@]2(OC1)O[C@H]1C[C@H]3[C@@H]4CC[C@@H]5C[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O)[C@H](O)[C@H]6O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]1[C@@H]2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asparagaceae | Asparagus racemosus  | Ref. |
| Plantae | Smilacaceae | Smilax aspera subsp.mauritanica (POIR.) ARCANG.  | Ref. |
|
|
zoom in
| Organism | Asparagus racemosus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|